C27H28O4S — CID 25034462
(3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxane-2-thione (PubChem CID 25034462) has the molecular formula C27H28O4S and a molecular weight of 448.58 g/mol. Its IUPAC name is (3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxane-2-thione.
| Compound Name | (3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxane-2-thione |
|---|---|
| PubChem CID | 25034462 |
| Molecular Formula | C27H28O4S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxane-2-thione |
| SMILES | C[C@@H]1OC(=S)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H28O4S/c1-20-24(28-17-21-11-5-2-6-12-21)25(29-18-22-13-7-3-8-14-22)26(27(32)31-20)30-19-23-15-9-4-10-16-23/h2-16,20,24-26H,17-19H2,1H3/t20-,24-,25+,26+/m0/s1 |
| InChIKey | AEHFWOKTUFASKD-JSKMBAMBSA-N |
| XLogP | 5.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|