C20H22O4 — CID 146795417
(3R)-2-methyl-3,5-bis(phenylmethoxy)oxan-4-one (PubChem CID 146795417) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is (3R)-2-methyl-3,5-bis(phenylmethoxy)oxan-4-one.
| Compound Name | (3R)-2-methyl-3,5-bis(phenylmethoxy)oxan-4-one |
|---|---|
| PubChem CID | 146795417 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (3R)-2-methyl-3,5-bis(phenylmethoxy)oxan-4-one |
| SMILES | CC1OCC(OCc2ccccc2)C(=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H22O4/c1-15-20(24-13-17-10-6-3-7-11-17)19(21)18(14-22-15)23-12-16-8-4-2-5-9-16/h2-11,15,18,20H,12-14H2,1H3/t15?,18?,20-/m1/s1 |
| InChIKey | RWQSZPLQVBZTMH-PKUWUEBNSA-N |
| XLogP | 3.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |