C16H23NO3 — CID 130205013
(3S,8R,9S)-3-amino-9-methyl-8-phenylmethoxyoxonan-2-one (PubChem CID 130205013) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (3S,8R,9S)-3-amino-9-methyl-8-phenylmethoxyoxonan-2-one.
| Compound Name | (3S,8R,9S)-3-amino-9-methyl-8-phenylmethoxyoxonan-2-one |
|---|---|
| PubChem CID | 130205013 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (3S,8R,9S)-3-amino-9-methyl-8-phenylmethoxyoxonan-2-one |
| SMILES | C[C@@H]1OC(=O)[C@@H](N)CCCC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C16H23NO3/c1-12-15(19-11-13-7-3-2-4-8-13)10-6-5-9-14(17)16(18)20-12/h2-4,7-8,12,14-15H,5-6,9-11,17H2,1H3/t12-,14-,15+/m0/s1 |
| InChIKey | KYURTYPPQFBVNI-AEGPPILISA-N |
| XLogP | 2.40 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |