C22H27NO2 — CID 118501786
(3S,7R,8S,9S)-3-amino-7-benzyl-9-methyl-8-phenyloxonan-2-one (PubChem CID 118501786) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (3S,7R,8S,9S)-3-amino-7-benzyl-9-methyl-8-phenyloxonan-2-one.
| Compound Name | (3S,7R,8S,9S)-3-amino-7-benzyl-9-methyl-8-phenyloxonan-2-one |
|---|---|
| PubChem CID | 118501786 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (3S,7R,8S,9S)-3-amino-7-benzyl-9-methyl-8-phenyloxonan-2-one |
| SMILES | C[C@@H]1OC(=O)[C@@H](N)CCC[C@H](Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H27NO2/c1-16-21(18-11-6-3-7-12-18)19(15-17-9-4-2-5-10-17)13-8-14-20(23)22(24)25-16/h2-7,9-12,16,19-21H,8,13-15,23H2,1H3/t16-,19+,20-,21+/m0/s1 |
| InChIKey | HBNUZSBVTAWALL-NASSWSRMSA-N |
| XLogP | 4.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |