C23H38O7 — CID 90320693
(1R,4R,5R,8R,9S,12R,14R)-9-butoxy-5-ethyl-4-hydroxy-4,8,12,14-tetramethyl-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione (PubChem CID 90320693) has the molecular formula C23H38O7 and a molecular weight of 426.55 g/mol. Its IUPAC name is (1R,4R,5R,8R,9S,12R,14R)-9-butoxy-5-ethyl-4-hydroxy-4,8,12,14-tetramethyl-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione.
| Compound Name | (1R,4R,5R,8R,9S,12R,14R)-9-butoxy-5-ethyl-4-hydroxy-4,8,12,14-tetramethyl-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione |
|---|---|
| PubChem CID | 90320693 |
| Molecular Formula | C23H38O7 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (1R,4R,5R,8R,9S,12R,14R)-9-butoxy-5-ethyl-4-hydroxy-4,8,12,14-tetramethyl-6,15-dioxabicyclo[10.2.1]pentadecane-3,7,11-trione |
| SMILES | CCCCO[C@H]1CC(=O)[C@@]2(C)C[C@@H](C)[C@@H](CC(=O)[C@](C)(O)[C@@H](CC)OC(=O)[C@@H]1C)O2 |
| InChI | InChI=1S/C23H38O7/c1-7-9-10-28-17-12-18(24)22(5)13-14(3)16(30-22)11-19(25)23(6,27)20(8-2)29-21(26)15(17)4/h14-17,20,27H,7-13H2,1-6H3/t14-,15-,16-,17+,20-,22-,23+/m1/s1 |
| InChIKey | ZWKZZCQPCULKQN-KHSSZCJPSA-N |
| XLogP | 3.00 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|