C23H38O8 — CID 90320715
(1R,2R,5R,6R,9R,10R,12S,14R)-9-butoxy-5-ethyl-6,14-dihydroxy-2,6,10,12-tetramethyl-4,15-dioxabicyclo[10.2.1]pentadecane-3,7,13-trione (PubChem CID 90320715) has the molecular formula C23H38O8 and a molecular weight of 442.55 g/mol. Its IUPAC name is (1R,2R,5R,6R,9R,10R,12S,14R)-9-butoxy-5-ethyl-6,14-dihydroxy-2,6,10,12-tetramethyl-4,15-dioxabicyclo[10.2.1]pentadecane-3,7,13-trione.
| Compound Name | (1R,2R,5R,6R,9R,10R,12S,14R)-9-butoxy-5-ethyl-6,14-dihydroxy-2,6,10,12-tetramethyl-4,15-dioxabicyclo[10.2.1]pentadecane-3,7,13-trione |
|---|---|
| PubChem CID | 90320715 |
| Molecular Formula | C23H38O8 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | (1R,2R,5R,6R,9R,10R,12S,14R)-9-butoxy-5-ethyl-6,14-dihydroxy-2,6,10,12-tetramethyl-4,15-dioxabicyclo[10.2.1]pentadecane-3,7,13-trione |
| SMILES | CCCCO[C@@H]1CC(=O)[C@](C)(O)[C@@H](CC)OC(=O)[C@H](C)[C@H]2O[C@@](C)(C[C@H]1C)C(=O)[C@@H]2O |
| InChI | InChI=1S/C23H38O8/c1-7-9-10-29-15-11-16(24)23(6,28)17(8-2)30-21(27)14(4)19-18(25)20(26)22(5,31-19)12-13(15)3/h13-15,17-19,25,28H,7-12H2,1-6H3/t13-,14-,15-,17-,18-,19-,22+,23+/m1/s1 |
| InChIKey | SUNMXRINKMDCLG-AAZUPPNMSA-N |
| XLogP | 1.97 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|