C10H17N3O4 — CID 126537592
(3S,4S,5R)-5-[(1S)-1-azidoethyl]-4-butoxy-3-hydroxyoxolan-2-one (PubChem CID 126537592) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is (3S,4S,5R)-5-[(1S)-1-azidoethyl]-4-butoxy-3-hydroxyoxolan-2-one.
| Compound Name | (3S,4S,5R)-5-[(1S)-1-azidoethyl]-4-butoxy-3-hydroxyoxolan-2-one |
|---|---|
| PubChem CID | 126537592 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | (3S,4S,5R)-5-[(1S)-1-azidoethyl]-4-butoxy-3-hydroxyoxolan-2-one |
| SMILES | CCCCO[C@@H]1[C@@H]([C@H](C)N=[N+]=[N-])OC(=O)[C@H]1O |
| InChI | InChI=1S/C10H17N3O4/c1-3-4-5-16-9-7(14)10(15)17-8(9)6(2)12-13-11/h6-9,14H,3-5H2,1-2H3/t6-,7-,8+,9-/m0/s1 |
| InChIKey | HEHDWSRPXXDBOU-MAUMQABQSA-N |
| XLogP | 1.16 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|