C30H45N3O11 — CID 126708018
benzyl (3S,6R)-6-[(1S)-2-acetyloxy-1-[(2R)-2-(1-azidoethyl)-1,3-dioxolan-4-yl]ethoxy]-4,5-dibutoxy-3-hydroxyoxane-2-carboxylate (PubChem CID 126708018) has the molecular formula C30H45N3O11 and a molecular weight of 623.70 g/mol. Its IUPAC name is benzyl (3S,6R)-6-[(1S)-2-acetyloxy-1-[(2R)-2-(1-azidoethyl)-1,3-dioxolan-4-yl]ethoxy]-4,5-dibutoxy-3-hydroxyoxane-2-carboxylate.
| Compound Name | benzyl (3S,6R)-6-[(1S)-2-acetyloxy-1-[(2R)-2-(1-azidoethyl)-1,3-dioxolan-4-yl]ethoxy]-4,5-dibutoxy-3-hydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 126708018 |
| Molecular Formula | C30H45N3O11 |
| Molecular Weight | 623.70 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | benzyl (3S,6R)-6-[(1S)-2-acetyloxy-1-[(2R)-2-(1-azidoethyl)-1,3-dioxolan-4-yl]ethoxy]-4,5-dibutoxy-3-hydroxyoxane-2-carboxylate |
| SMILES | CCCCOC1C(OCCCC)[C@H](O)C(C(=O)OCc2ccccc2)O[C@H]1O[C@@H](COC(C)=O)C1CO[C@@H](C(C)N=[N+]=[N-])O1 |
| InChI | InChI=1S/C30H45N3O11/c1-5-7-14-37-25-24(35)26(28(36)40-16-21-12-10-9-11-13-21)44-30(27(25)38-15-8-6-2)43-22(17-39-20(4)34)23-18-41-29(42-23)19(3)32-33-31/h9-13,19,22-27,29-30,35H,5-8,14-18H2,1-4H3/t19?,22-,23?,24-,25?,26?,27?,29+,30+/m0/s1 |
| InChIKey | BFUDTYZGTAKFHZ-ZNMNMAGLSA-N |
| XLogP | 3.57 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|