C34H42O15 — CID 90893342
benzyl (3S,5R,6R)-6-[(3R,6S)-4,6-diacetyloxy-2-(acetyloxymethyl)-5-phenylmethoxyoxan-3-yl]oxy-3-hydroxy-4,5-dimethoxyoxane-2-carboxylate (PubChem CID 90893342) has the molecular formula C34H42O15 and a molecular weight of 690.70 g/mol. Its IUPAC name is benzyl (3S,5R,6R)-6-[(3R,6S)-4,6-diacetyloxy-2-(acetyloxymethyl)-5-phenylmethoxyoxan-3-yl]oxy-3-hydroxy-4,5-dimethoxyoxane-2-carboxylate.
| Compound Name | benzyl (3S,5R,6R)-6-[(3R,6S)-4,6-diacetyloxy-2-(acetyloxymethyl)-5-phenylmethoxyoxan-3-yl]oxy-3-hydroxy-4,5-dimethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 90893342 |
| Molecular Formula | C34H42O15 |
| Molecular Weight | 690.70 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | benzyl (3S,5R,6R)-6-[(3R,6S)-4,6-diacetyloxy-2-(acetyloxymethyl)-5-phenylmethoxyoxan-3-yl]oxy-3-hydroxy-4,5-dimethoxyoxane-2-carboxylate |
| SMILES | COC1[C@H](O)C(C(=O)OCc2ccccc2)O[C@@H](O[C@@H]2C(COC(C)=O)O[C@@H](OC(C)=O)C(OCc3ccccc3)C2OC(C)=O)[C@@H]1OC |
| InChI | InChI=1S/C34H42O15/c1-19(35)42-18-24-26(29(45-20(2)36)31(34(47-24)46-21(3)37)43-16-22-12-8-6-9-13-22)48-33-30(41-5)27(40-4)25(38)28(49-33)32(39)44-17-23-14-10-7-11-15-23/h6-15,24-31,33-34,38H,16-18H2,1-5H3/t24?,25-,26+,27?,28?,29?,30+,31?,33+,34+/m0/s1 |
| InChIKey | VDTGMVUCTPPMTL-SYIBJBJASA-N |
| XLogP | 1.60 |
| TPSA | 180.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.70 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|