C14H19N3O3 — CID 54266414
(2S,4R,5R)-5-(1-azidoethyl)-2-methyl-4-phenylmethoxyoxolan-3-ol (PubChem CID 54266414) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (2S,4R,5R)-5-(1-azidoethyl)-2-methyl-4-phenylmethoxyoxolan-3-ol.
| Compound Name | (2S,4R,5R)-5-(1-azidoethyl)-2-methyl-4-phenylmethoxyoxolan-3-ol |
|---|---|
| PubChem CID | 54266414 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (2S,4R,5R)-5-(1-azidoethyl)-2-methyl-4-phenylmethoxyoxolan-3-ol |
| SMILES | CC(N=[N+]=[N-])[C@H]1O[C@@H](C)C(O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H19N3O3/c1-9(16-17-15)13-14(12(18)10(2)20-13)19-8-11-6-4-3-5-7-11/h3-7,9-10,12-14,18H,8H2,1-2H3/t9?,10-,12?,13+,14+/m0/s1 |
| InChIKey | RHBOZIVLOYWURS-JHTCYFJLSA-N |
| XLogP | 2.42 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|