C18H33NO5 — CID 100955586
methyl (3aS,4R,7R,7aR)-7-butoxy-5-butyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxylate (PubChem CID 100955586) has the molecular formula C18H33NO5 and a molecular weight of 343.46 g/mol. Its IUPAC name is methyl (3aS,4R,7R,7aR)-7-butoxy-5-butyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxylate.
| Compound Name | methyl (3aS,4R,7R,7aR)-7-butoxy-5-butyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 100955586 |
| Molecular Formula | C18H33NO5 |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | methyl (3aS,4R,7R,7aR)-7-butoxy-5-butyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-4-carboxylate |
| SMILES | CCCCO[C@@H]1CN(CCCC)[C@@H](C(=O)OC)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H33NO5/c1-6-8-10-19-12-13(22-11-9-7-2)15-16(14(19)17(20)21-5)24-18(3,4)23-15/h13-16H,6-12H2,1-5H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | ALVLTGNGDRCDNB-FPCVCCKLSA-N |
| XLogP | 2.35 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|