methyl 3-methyl-3-pentyloxirane-2-carboxylate

C10H18O3 — CID 80558710

IUPACmethyl 3-methyl-3-pentyloxirane-2-carboxylate
SMILESCCCCCC1(C)OC1C(=O)OC
InChIInChI=1S/C10H18O3/c1-4-5-6-7-10(2)8(13-10)9(11)12-3/h8H,4-7H2,1-3H3
InChIKeyWDTICKSSCTWXFL-UHFFFAOYSA-N
MW186.25 g/mol
LogP1.90
Rot. Bonds5

About methyl 3-methyl-3-pentyloxirane-2-carboxylate

methyl 3-methyl-3-pentyloxirane-2-carboxylate (PubChem CID 80558710) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl 3-methyl-3-pentyloxirane-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-methyl-3-pentyloxirane-2-carboxylate
PubChem CID80558710
Molecular FormulaC10H18O3
Molecular Weight186.25 g/mol
Exact Mass186.13
IUPAC Namemethyl 3-methyl-3-pentyloxirane-2-carboxylate
SMILESCCCCCC1(C)OC1C(=O)OC
InChIInChI=1S/C10H18O3/c1-4-5-6-7-10(2)8(13-10)9(11)12-3/h8H,4-7H2,1-3H3
InChIKeyWDTICKSSCTWXFL-UHFFFAOYSA-N
XLogP1.90
TPSA38.83 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.25
LogP ≤ 51.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze methyl 3-methyl-3-pentyloxirane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-methyl-3-pentyloxirane-2-carboxylate?
The IUPAC name of methyl 3-methyl-3-pentyloxirane-2-carboxylate (CID 80558710) is methyl 3-methyl-3-pentyloxirane-2-carboxylate.
What is the SMILES notation for methyl 3-methyl-3-pentyloxirane-2-carboxylate?
The canonical SMILES for methyl 3-methyl-3-pentyloxirane-2-carboxylate is CCCCCC1(C)OC1C(=O)OC.
What is the InChIKey of methyl 3-methyl-3-pentyloxirane-2-carboxylate?
The InChIKey is WDTICKSSCTWXFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-4-5-6-7-10(2)8(13-10)9(11)12-3/h8H,4-7H2,1-3H3.
What are the key properties of methyl 3-methyl-3-pentyloxirane-2-carboxylate?
methyl 3-methyl-3-pentyloxirane-2-carboxylate has a molecular weight of 186.25 g/mol, XLogP of 1.90, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-3-pentyloxirane-2-carboxylate is sourced from PubChem (CID 80558710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).