C22H33NO5 — CID 122657805
benzyl (3aR,6R,7R,7aR)-7-(hydroxymethyl)-2,2-dimethyl-6-pentyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate (PubChem CID 122657805) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is benzyl (3aR,6R,7R,7aR)-7-(hydroxymethyl)-2,2-dimethyl-6-pentyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | benzyl (3aR,6R,7R,7aR)-7-(hydroxymethyl)-2,2-dimethyl-6-pentyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 122657805 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | benzyl (3aR,6R,7R,7aR)-7-(hydroxymethyl)-2,2-dimethyl-6-pentyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
| SMILES | CCCCC[C@@H]1[C@H](CO)[C@H]2OC(C)(C)O[C@@H]2CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H33NO5/c1-4-5-7-12-18-17(14-24)20-19(27-22(2,3)28-20)13-23(18)21(25)26-15-16-10-8-6-9-11-16/h6,8-11,17-20,24H,4-5,7,12-15H2,1-3H3/t17-,18+,19+,20+/m0/s1 |
| InChIKey | VDNLLUGSLORVBM-MTQWCTHYSA-N |
| XLogP | 3.72 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|