About benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate
benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate (PubChem CID 155543608) has the molecular formula C18H27NO4
and a molecular weight of 321.42 g/mol. Its IUPAC name is benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate |
| PubChem CID | 155543608 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate |
| SMILES | CCCCCCCC1CN(C(=O)OCc2ccccc2)OC1O |
| InChI | InChI=1S/C18H27NO4/c1-2-3-4-5-9-12-16-13-19(23-17(16)20)18(21)22-14-15-10-7-6-8-11-15/h6-8,10-11,16-17,20H,2-5,9,12-14H2,1H3 |
| InChIKey | BDIKNOIUVJVFSM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate?
The IUPAC name of benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate (CID 155543608) is benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate.
What is the SMILES notation for benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate?
The canonical SMILES for benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate is CCCCCCCC1CN(C(=O)OCc2ccccc2)OC1O.
What is the InChIKey of benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate?
The InChIKey is BDIKNOIUVJVFSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO4/c1-2-3-4-5-9-12-16-13-19(23-17(16)20)18(21)22-14-15-10-7-6-8-11-15/h6-8,10-11,16-17,20H,2-5,9,12-14H2,1H3.
What are the key properties of benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate?
benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate has a molecular weight of 321.42 g/mol, XLogP of 3.87, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-heptyl-5-hydroxy-1,2-oxazolidine-2-carboxylate is sourced from PubChem (CID 155543608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).