C20H31NO4Sn — CID 16686443
benzyl (3aR,6aR)-2,2-dibutyl-3a,4,6,6a-tetrahydro-[1,3,2]dioxastannolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 16686443) has the molecular formula C20H31NO4Sn and a molecular weight of 468.18 g/mol. Its IUPAC name is benzyl (3aR,6aR)-2,2-dibutyl-3a,4,6,6a-tetrahydro-[1,3,2]dioxastannolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | benzyl (3aR,6aR)-2,2-dibutyl-3a,4,6,6a-tetrahydro-[1,3,2]dioxastannolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 16686443 |
| Molecular Formula | C20H31NO4Sn |
| Molecular Weight | 468.18 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | benzyl (3aR,6aR)-2,2-dibutyl-3a,4,6,6a-tetrahydro-[1,3,2]dioxastannolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CCCC[Sn]1(CCCC)O[C@@H]2CN(C(=O)OCc3ccccc3)C[C@H]2O1 |
| InChI | InChI=1S/C12H13NO4.2C4H9.Sn/c14-10-6-13(7-11(10)15)12(16)17-8-9-4-2-1-3-5-9;2*1-3-4-2;/h1-5,10-11H,6-8H2;2*1,3-4H2,2H3;/q-2;;;+2/t10-,11-;;;/m1.../s1 |
| InChIKey | MMKVMFGSEZLSBJ-UWIDVKDSSA-N |
| XLogP | 4.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.18 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |