C14H27NO5 — CID 141246983
butyl (2R,3R,4R,5S)-1-butyl-3,4,5-trihydroxypiperidine-2-carboxylate (PubChem CID 141246983) has the molecular formula C14H27NO5 and a molecular weight of 289.37 g/mol. Its IUPAC name is butyl (2R,3R,4R,5S)-1-butyl-3,4,5-trihydroxypiperidine-2-carboxylate.
| Compound Name | butyl (2R,3R,4R,5S)-1-butyl-3,4,5-trihydroxypiperidine-2-carboxylate |
|---|---|
| PubChem CID | 141246983 |
| Molecular Formula | C14H27NO5 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | butyl (2R,3R,4R,5S)-1-butyl-3,4,5-trihydroxypiperidine-2-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCC |
| InChI | InChI=1S/C14H27NO5/c1-3-5-7-15-9-10(16)12(17)13(18)11(15)14(19)20-8-6-4-2/h10-13,16-18H,3-9H2,1-2H3/t10-,11+,12+,13+/m0/s1 |
| InChIKey | GZLNRMKQIZBCGB-UMSGYPCISA-N |
| XLogP | -0.10 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|