C13H25NO3 — CID 69001506
butyl (2R)-1-tert-butyl-3-hydroxypyrrolidine-2-carboxylate (PubChem CID 69001506) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is butyl (2R)-1-tert-butyl-3-hydroxypyrrolidine-2-carboxylate.
| Compound Name | butyl (2R)-1-tert-butyl-3-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 69001506 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | butyl (2R)-1-tert-butyl-3-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1C(O)CCN1C(C)(C)C |
| InChI | InChI=1S/C13H25NO3/c1-5-6-9-17-12(16)11-10(15)7-8-14(11)13(2,3)4/h10-11,15H,5-9H2,1-4H3/t10?,11-/m1/s1 |
| InChIKey | ATZZKHIFQKAKLG-RRKGBCIJSA-N |
| XLogP | 1.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|