C17H31FO5 — CID 122453429
(3aS,5R,6aS)-6-butoxy-5-(butoxymethyl)-5-(fluoromethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole (PubChem CID 122453429) has the molecular formula C17H31FO5 and a molecular weight of 334.43 g/mol. Its IUPAC name is (3aS,5R,6aS)-6-butoxy-5-(butoxymethyl)-5-(fluoromethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole.
| Compound Name | (3aS,5R,6aS)-6-butoxy-5-(butoxymethyl)-5-(fluoromethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 122453429 |
| Molecular Formula | C17H31FO5 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | (3aS,5R,6aS)-6-butoxy-5-(butoxymethyl)-5-(fluoromethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
| SMILES | CCCCOC[C@@]1(CF)O[C@H]2OC(C)(C)O[C@H]2C1OCCCC |
| InChI | InChI=1S/C17H31FO5/c1-5-7-9-19-12-17(11-18)14(20-10-8-6-2)13-15(23-17)22-16(3,4)21-13/h13-15H,5-12H2,1-4H3/t13-,14?,15+,17+/m0/s1 |
| InChIKey | OATPYYPWORXRHM-UNHJMDIJSA-N |
| XLogP | 3.20 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|