C17H32O5 — CID 70985270
[(5R)-4-butoxy-5-(butoxymethyl)-5-ethyloxolan-3-yl] acetate (PubChem CID 70985270) has the molecular formula C17H32O5 and a molecular weight of 316.44 g/mol. Its IUPAC name is [(5R)-4-butoxy-5-(butoxymethyl)-5-ethyloxolan-3-yl] acetate.
| Compound Name | [(5R)-4-butoxy-5-(butoxymethyl)-5-ethyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 70985270 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [(5R)-4-butoxy-5-(butoxymethyl)-5-ethyloxolan-3-yl] acetate |
| SMILES | CCCCOC[C@@]1(CC)OCC(OC(C)=O)C1OCCCC |
| InChI | InChI=1S/C17H32O5/c1-5-8-10-19-13-17(7-3)16(20-11-9-6-2)15(12-21-17)22-14(4)18/h15-16H,5-13H2,1-4H3/t15?,16?,17-/m1/s1 |
| InChIKey | FZKPVWQUKUKTPC-OFLPRAFFSA-N |
| XLogP | 3.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|