C12H17FO7 — CID 134366275
[(2R,3S,4S)-3,4-diacetyloxy-2-(fluoromethyl)oxolan-2-yl]methyl acetate (PubChem CID 134366275) has the molecular formula C12H17FO7 and a molecular weight of 292.26 g/mol. Its IUPAC name is [(2R,3S,4S)-3,4-diacetyloxy-2-(fluoromethyl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S)-3,4-diacetyloxy-2-(fluoromethyl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134366275 |
| Molecular Formula | C12H17FO7 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | [(2R,3S,4S)-3,4-diacetyloxy-2-(fluoromethyl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(CF)OC[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H17FO7/c1-7(14)17-6-12(5-13)11(20-9(3)16)10(4-18-12)19-8(2)15/h10-11H,4-6H2,1-3H3/t10-,11-,12+/m0/s1 |
| InChIKey | FCASBDHHOLQCLI-SDDRHHMPSA-N |
| XLogP | 0.15 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|