C12H14FNO7 — CID 100916550
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-cyano-6-fluorooxan-3-yl] acetate (PubChem CID 100916550) has the molecular formula C12H14FNO7 and a molecular weight of 303.24 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-cyano-6-fluorooxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-cyano-6-fluorooxan-3-yl] acetate |
|---|---|
| PubChem CID | 100916550 |
| Molecular Formula | C12H14FNO7 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-cyano-6-fluorooxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@](F)(C#N)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H14FNO7/c1-6(15)19-9-4-18-12(13,5-14)11(21-8(3)17)10(9)20-7(2)16/h9-11H,4H2,1-3H3/t9-,10+,11-,12+/m1/s1 |
| InChIKey | TVLDSZTUKGEGGQ-KXNHARMFSA-N |
| XLogP | 0.00 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|