C31H32O9 — CID 171126987
[(3R,4R,5R,6R)-4,5-diacetyloxy-6-hydroxy-6-(trityloxymethyl)oxan-3-yl] acetate (PubChem CID 171126987) has the molecular formula C31H32O9 and a molecular weight of 548.59 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-4,5-diacetyloxy-6-hydroxy-6-(trityloxymethyl)oxan-3-yl] acetate.
| Compound Name | [(3R,4R,5R,6R)-4,5-diacetyloxy-6-hydroxy-6-(trityloxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 171126987 |
| Molecular Formula | C31H32O9 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | [(3R,4R,5R,6R)-4,5-diacetyloxy-6-hydroxy-6-(trityloxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)[C@@](O)(COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H32O9/c1-21(32)38-27-19-36-30(35,29(40-23(3)34)28(27)39-22(2)33)20-37-31(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-18,27-29,35H,19-20H2,1-3H3/t27-,28-,29-,30-/m1/s1 |
| InChIKey | KXDWKZBWKWVUFR-SKKKGAJSSA-N |
| XLogP | 3.51 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|