C14H18N2O8 — CID 100964098
[(3R,4R,5S,6R)-6-acetamido-4,5-diacetyloxy-6-cyanooxan-3-yl] acetate (PubChem CID 100964098) has the molecular formula C14H18N2O8 and a molecular weight of 342.30 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-6-acetamido-4,5-diacetyloxy-6-cyanooxan-3-yl] acetate.
| Compound Name | [(3R,4R,5S,6R)-6-acetamido-4,5-diacetyloxy-6-cyanooxan-3-yl] acetate |
|---|---|
| PubChem CID | 100964098 |
| Molecular Formula | C14H18N2O8 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | [(3R,4R,5S,6R)-6-acetamido-4,5-diacetyloxy-6-cyanooxan-3-yl] acetate |
| SMILES | CC(=O)N[C@]1(C#N)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H18N2O8/c1-7(17)16-14(6-15)13(24-10(4)20)12(23-9(3)19)11(5-21-14)22-8(2)18/h11-13H,5H2,1-4H3,(H,16,17)/t11-,12-,13+,14-/m1/s1 |
| InChIKey | JGMNHIUTNVWLEQ-YIYPIFLZSA-N |
| XLogP | -0.83 |
| TPSA | 141.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|