C10H15NO6 — CID 10037500
[(3S,4S,5S)-4-acetamido-5-acetyloxyoxolan-3-yl] acetate (PubChem CID 10037500) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is [(3S,4S,5S)-4-acetamido-5-acetyloxyoxolan-3-yl] acetate.
| Compound Name | [(3S,4S,5S)-4-acetamido-5-acetyloxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 10037500 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | [(3S,4S,5S)-4-acetamido-5-acetyloxyoxolan-3-yl] acetate |
| SMILES | CC(=O)N[C@@H]1[C@H](OC(C)=O)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H15NO6/c1-5(12)11-9-8(16-6(2)13)4-15-10(9)17-7(3)14/h8-10H,4H2,1-3H3,(H,11,12)/t8-,9+,10+/m1/s1 |
| InChIKey | FRWOKRZITKGUQD-UTLUCORTSA-N |
| XLogP | -0.66 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |