C12H19NO7 — CID 14483133
[(2S,3R,4S,5R)-5-acetamido-3-acetyloxy-2-methoxyoxan-4-yl] acetate (PubChem CID 14483133) has the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-5-acetamido-3-acetyloxy-2-methoxyoxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S,5R)-5-acetamido-3-acetyloxy-2-methoxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 14483133 |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | [(2S,3R,4S,5R)-5-acetamido-3-acetyloxy-2-methoxyoxan-4-yl] acetate |
| SMILES | CO[C@H]1OC[C@@H](NC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H19NO7/c1-6(14)13-9-5-18-12(17-4)11(20-8(3)16)10(9)19-7(2)15/h9-12H,5H2,1-4H3,(H,13,14)/t9-,10+,11-,12+/m1/s1 |
| InChIKey | ZLVZLOLSENVJJX-KXNHARMFSA-N |
| XLogP | -0.64 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |