C24H38O12 — CID 58510377
[(2R,3S,4S,5R,6S)-4,5,6-trimethyl-2-[(3R,4R,5S,6S,7S)-4,5,6-triacetyloxy-7-methoxyoxepan-3-yl]oxyoxepan-3-yl] acetate (PubChem CID 58510377) has the molecular formula C24H38O12 and a molecular weight of 518.56 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-4,5,6-trimethyl-2-[(3R,4R,5S,6S,7S)-4,5,6-triacetyloxy-7-methoxyoxepan-3-yl]oxyoxepan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-4,5,6-trimethyl-2-[(3R,4R,5S,6S,7S)-4,5,6-triacetyloxy-7-methoxyoxepan-3-yl]oxyoxepan-3-yl] acetate |
|---|---|
| PubChem CID | 58510377 |
| Molecular Formula | C24H38O12 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-4,5,6-trimethyl-2-[(3R,4R,5S,6S,7S)-4,5,6-triacetyloxy-7-methoxyoxepan-3-yl]oxyoxepan-3-yl] acetate |
| SMILES | CO[C@H]1OC[C@@H](O[C@H]2OC[C@@H](C)[C@@H](C)[C@H](C)[C@@H]2OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H38O12/c1-11-9-30-24(19(32-14(4)25)13(3)12(11)2)36-18-10-31-23(29-8)22(35-17(7)28)21(34-16(6)27)20(18)33-15(5)26/h11-13,18-24H,9-10H2,1-8H3/t11-,12-,13+,18-,19+,20-,21+,22+,23+,24-/m1/s1 |
| InChIKey | YNXCTEYTVKFTPE-JOIMLAKGSA-N |
| XLogP | 1.37 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|