C10H19NO9S2 — CID 97046230
[(3R,4R,5R,6S)-4-acetamido-6-methoxy-5-methylsulfonyloxyoxan-3-yl] methanesulfonate (PubChem CID 97046230) has the molecular formula C10H19NO9S2 and a molecular weight of 361.39 g/mol. Its IUPAC name is [(3R,4R,5R,6S)-4-acetamido-6-methoxy-5-methylsulfonyloxyoxan-3-yl] methanesulfonate.
| Compound Name | [(3R,4R,5R,6S)-4-acetamido-6-methoxy-5-methylsulfonyloxyoxan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 97046230 |
| Molecular Formula | C10H19NO9S2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | [(3R,4R,5R,6S)-4-acetamido-6-methoxy-5-methylsulfonyloxyoxan-3-yl] methanesulfonate |
| SMILES | CO[C@H]1OC[C@H](OS(C)(=O)=O)[C@@H](NC(C)=O)[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C10H19NO9S2/c1-6(12)11-8-7(19-21(3,13)14)5-18-10(17-2)9(8)20-22(4,15)16/h7-10H,5H2,1-4H3,(H,11,12)/t7-,8+,9+,10-/m0/s1 |
| InChIKey | MVBQDYJUAUZNRD-JLIMGVALSA-N |
| XLogP | -1.82 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|