C19H29NO11 — CID 177418404
methyl (4R,5R)-3,4,5-triacetyloxy-2-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]oxane-2-carboxylate (PubChem CID 177418404) has the molecular formula C19H29NO11 and a molecular weight of 447.44 g/mol. Its IUPAC name is methyl (4R,5R)-3,4,5-triacetyloxy-2-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]oxane-2-carboxylate.
| Compound Name | methyl (4R,5R)-3,4,5-triacetyloxy-2-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]oxane-2-carboxylate |
|---|---|
| PubChem CID | 177418404 |
| Molecular Formula | C19H29NO11 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | methyl (4R,5R)-3,4,5-triacetyloxy-2-[(1-methoxy-3-methyl-1-oxobutan-2-yl)amino]oxane-2-carboxylate |
| SMILES | COC(=O)C(NC1(C(=O)OC)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1OC(C)=O)C(C)C |
| InChI | InChI=1S/C19H29NO11/c1-9(2)14(17(24)26-6)20-19(18(25)27-7)16(31-12(5)23)15(30-11(4)22)13(8-28-19)29-10(3)21/h9,13-16,20H,8H2,1-7H3/t13-,14?,15-,16?,19?/m1/s1 |
| InChIKey | QYZMCNYPAUETLM-OLRDNMBDSA-N |
| XLogP | -0.53 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|