C18H34O6 — CID 118595842
1-[(2R,4R)-3-butoxy-2-(butoxymethyl)-4-(2-hydroxypropan-2-yloxy)oxolan-2-yl]ethanone (PubChem CID 118595842) has the molecular formula C18H34O6 and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-[(2R,4R)-3-butoxy-2-(butoxymethyl)-4-(2-hydroxypropan-2-yloxy)oxolan-2-yl]ethanone.
| Compound Name | 1-[(2R,4R)-3-butoxy-2-(butoxymethyl)-4-(2-hydroxypropan-2-yloxy)oxolan-2-yl]ethanone |
|---|---|
| PubChem CID | 118595842 |
| Molecular Formula | C18H34O6 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-[(2R,4R)-3-butoxy-2-(butoxymethyl)-4-(2-hydroxypropan-2-yloxy)oxolan-2-yl]ethanone |
| SMILES | CCCCOC[C@@]1(C(C)=O)OC[C@@H](OC(C)(C)O)C1OCCCC |
| InChI | InChI=1S/C18H34O6/c1-6-8-10-21-13-18(14(3)19)16(22-11-9-7-2)15(12-23-18)24-17(4,5)20/h15-16,20H,6-13H2,1-5H3/t15-,16?,18+/m1/s1 |
| InChIKey | KOBWYDYFRZMNBJ-AGPBCMBSSA-N |
| XLogP | 2.46 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|