C15H27NO5 — CID 118266692
1-O-tert-butyl 2-O-methyl (2S,3R)-3-butoxypyrrolidine-1,2-dicarboxylate (PubChem CID 118266692) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,3R)-3-butoxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,3R)-3-butoxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 118266692 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,3R)-3-butoxypyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCO[C@@H]1CCN(C(=O)OC(C)(C)C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C15H27NO5/c1-6-7-10-20-11-8-9-16(12(11)13(17)19-5)14(18)21-15(2,3)4/h11-12H,6-10H2,1-5H3/t11-,12+/m1/s1 |
| InChIKey | MUXIZAQYQOSQFW-NEPJUHHUSA-N |
| XLogP | 2.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|