C19H33NO6 — CID 166855734
1-O-tert-butyl 2-O-methyl (2S,3R)-3-[(3R)-3-ethyl-6-oxohexoxy]pyrrolidine-1,2-dicarboxylate (PubChem CID 166855734) has the molecular formula C19H33NO6 and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,3R)-3-[(3R)-3-ethyl-6-oxohexoxy]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,3R)-3-[(3R)-3-ethyl-6-oxohexoxy]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 166855734 |
| Molecular Formula | C19H33NO6 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,3R)-3-[(3R)-3-ethyl-6-oxohexoxy]pyrrolidine-1,2-dicarboxylate |
| SMILES | CC[C@H](CCC=O)CCO[C@@H]1CCN(C(=O)OC(C)(C)C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C19H33NO6/c1-6-14(8-7-12-21)10-13-25-15-9-11-20(16(15)17(22)24-5)18(23)26-19(2,3)4/h12,14-16H,6-11,13H2,1-5H3/t14-,15-,16+/m1/s1 |
| InChIKey | DDMFDFLVMICFKJ-OAGGEKHMSA-N |
| XLogP | 2.95 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|