C20H35N3O6 — CID 118359707
1-O,4-O-ditert-butyl 2-O-methyl (2R,3S)-3-[(cyclopropylamino)methyl]piperazine-1,2,4-tricarboxylate (PubChem CID 118359707) has the molecular formula C20H35N3O6 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-O,4-O-ditert-butyl 2-O-methyl (2R,3S)-3-[(cyclopropylamino)methyl]piperazine-1,2,4-tricarboxylate.
| Compound Name | 1-O,4-O-ditert-butyl 2-O-methyl (2R,3S)-3-[(cyclopropylamino)methyl]piperazine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 118359707 |
| Molecular Formula | C20H35N3O6 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 1-O,4-O-ditert-butyl 2-O-methyl (2R,3S)-3-[(cyclopropylamino)methyl]piperazine-1,2,4-tricarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](CNC2CC2)N(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H35N3O6/c1-19(2,3)28-17(25)22-10-11-23(18(26)29-20(4,5)6)15(16(24)27-7)14(22)12-21-13-8-9-13/h13-15,21H,8-12H2,1-7H3/t14-,15+/m0/s1 |
| InChIKey | XISDZBKTOALDMJ-LSDHHAIUSA-N |
| XLogP | 2.14 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|