C18H31F3O8S — CID 88576267
[(3aR,5R)-6-butoxy-5-(butoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate (PubChem CID 88576267) has the molecular formula C18H31F3O8S and a molecular weight of 464.50 g/mol. Its IUPAC name is [(3aR,5R)-6-butoxy-5-(butoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(3aR,5R)-6-butoxy-5-(butoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88576267 |
| Molecular Formula | C18H31F3O8S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | [(3aR,5R)-6-butoxy-5-(butoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate |
| SMILES | CCCCOC[C@]1(COS(=O)(=O)C(F)(F)F)O[C@@H]2OC(C)(C)OC2C1OCCCC |
| InChI | InChI=1S/C18H31F3O8S/c1-5-7-9-24-11-17(12-26-30(22,23)18(19,20)21)14(25-10-8-6-2)13-15(29-17)28-16(3,4)27-13/h13-15H,5-12H2,1-4H3/t13?,14?,15-,17+/m0/s1 |
| InChIKey | KWRAGYWGBSRYBO-UMPYDWHISA-N |
| XLogP | 3.10 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|