C22H41F2O8P — CID 88576273
(3aR,5S)-6-butoxy-5-(butoxymethyl)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole (PubChem CID 88576273) has the molecular formula C22H41F2O8P and a molecular weight of 502.53 g/mol. Its IUPAC name is (3aR,5S)-6-butoxy-5-(butoxymethyl)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5S)-6-butoxy-5-(butoxymethyl)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 88576273 |
| Molecular Formula | C22H41F2O8P |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | (3aR,5S)-6-butoxy-5-(butoxymethyl)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
| SMILES | CCCCOC[C@]1(CC(F)(F)P(=O)(OCC)OCC)O[C@@H]2OC(C)(C)OC2C1OCCCC |
| InChI | InChI=1S/C22H41F2O8P/c1-7-11-13-26-16-21(15-22(23,24)33(25,28-9-3)29-10-4)18(27-14-12-8-2)17-19(32-21)31-20(5,6)30-17/h17-19H,7-16H2,1-6H3/t17?,18?,19-,21-/m0/s1 |
| InChIKey | AUBZJLYRKGAJAY-XSNSTOHYSA-N |
| XLogP | 5.48 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|