About 1-diethoxyphosphoryl-1,1-difluorohexane
1-diethoxyphosphoryl-1,1-difluorohexane (PubChem CID 10445215) has the molecular formula C10H21F2O3P
and a molecular weight of 258.24 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluorohexane.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-1,1-difluorohexane |
| PubChem CID | 10445215 |
| Molecular Formula | C10H21F2O3P |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluorohexane |
| SMILES | CCCCCC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H21F2O3P/c1-4-7-8-9-10(11,12)16(13,14-5-2)15-6-3/h4-9H2,1-3H3 |
| InChIKey | YXKHQKZHPQZLSZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-1,1-difluorohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-1,1-difluorohexane?
The IUPAC name of 1-diethoxyphosphoryl-1,1-difluorohexane (CID 10445215) is 1-diethoxyphosphoryl-1,1-difluorohexane.
What is the SMILES notation for 1-diethoxyphosphoryl-1,1-difluorohexane?
The canonical SMILES for 1-diethoxyphosphoryl-1,1-difluorohexane is CCCCCC(F)(F)P(=O)(OCC)OCC.
What is the InChIKey of 1-diethoxyphosphoryl-1,1-difluorohexane?
The InChIKey is YXKHQKZHPQZLSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F2O3P/c1-4-7-8-9-10(11,12)16(13,14-5-2)15-6-3/h4-9H2,1-3H3.
What are the key properties of 1-diethoxyphosphoryl-1,1-difluorohexane?
1-diethoxyphosphoryl-1,1-difluorohexane has a molecular weight of 258.24 g/mol, XLogP of 4.43, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-1,1-difluorohexane is sourced from PubChem (CID 10445215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).