C10H21F2O3P — CID 10445215
1-diethoxyphosphoryl-1,1-difluorohexane (PubChem CID 10445215) has the molecular formula C10H21F2O3P and a molecular weight of 258.24 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluorohexane.
| Compound Name | 1-diethoxyphosphoryl-1,1-difluorohexane |
|---|---|
| PubChem CID | 10445215 |
| Molecular Formula | C10H21F2O3P |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluorohexane |
| SMILES | CCCCCC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H21F2O3P/c1-4-7-8-9-10(11,12)16(13,14-5-2)15-6-3/h4-9H2,1-3H3 |
| InChIKey | YXKHQKZHPQZLSZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|