C16H33F2O3P — CID 15272233
1-diethoxyphosphoryl-1,1-difluoro-2-methylundecane (PubChem CID 15272233) has the molecular formula C16H33F2O3P and a molecular weight of 342.41 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluoro-2-methylundecane.
| Compound Name | 1-diethoxyphosphoryl-1,1-difluoro-2-methylundecane |
|---|---|
| PubChem CID | 15272233 |
| Molecular Formula | C16H33F2O3P |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluoro-2-methylundecane |
| SMILES | CCCCCCCCCC(C)C(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H33F2O3P/c1-5-8-9-10-11-12-13-14-15(4)16(17,18)22(19,20-6-2)21-7-3/h15H,5-14H2,1-4H3 |
| InChIKey | QMKAAKPOHZAVHC-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|