C40H84O6 — CID 159703510
1,1,1-tributoxy-2-methyldecane;1,1,1-triethoxy-2-methyldecane (PubChem CID 159703510) has the molecular formula C40H84O6 and a molecular weight of 661.11 g/mol. Its IUPAC name is 1,1,1-tributoxy-2-methyldecane;1,1,1-triethoxy-2-methyldecane.
| Compound Name | 1,1,1-tributoxy-2-methyldecane;1,1,1-triethoxy-2-methyldecane |
|---|---|
| PubChem CID | 159703510 |
| Molecular Formula | C40H84O6 |
| Molecular Weight | 661.11 g/mol |
| Exact Mass | 660.63 |
| IUPAC Name | 1,1,1-tributoxy-2-methyldecane;1,1,1-triethoxy-2-methyldecane |
| SMILES | CCCCCCCCC(C)C(OCC)(OCC)OCC.CCCCCCCCC(C)C(OCCCC)(OCCCC)OCCCC |
| InChI | InChI=1S/C23H48O3.C17H36O3/c1-6-10-14-15-16-17-18-22(5)23(24-19-11-7-2,25-20-12-8-3)26-21-13-9-4;1-6-10-11-12-13-14-15-16(5)17(18-7-2,19-8-3)20-9-4/h22H,6-21H2,1-5H3;16H,6-15H2,1-5H3 |
| InChIKey | MXXORDXIDZZOSE-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.11 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|