C60H123O13P — CID 87576352
tris(1,1,2-tributoxyoctyl) phosphate (PubChem CID 87576352) has the molecular formula C60H123O13P and a molecular weight of 1083.60 g/mol. Its IUPAC name is tris(1,1,2-tributoxyoctyl) phosphate.
| Compound Name | tris(1,1,2-tributoxyoctyl) phosphate |
|---|---|
| PubChem CID | 87576352 |
| Molecular Formula | C60H123O13P |
| Molecular Weight | 1083.60 g/mol |
| Exact Mass | 1082.87 |
| IUPAC Name | tris(1,1,2-tributoxyoctyl) phosphate |
| SMILES | CCCCCCC(OCCCC)C(OCCCC)(OCCCC)OP(=O)(OC(OCCCC)(OCCCC)C(CCCCCC)OCCCC)OC(OCCCC)(OCCCC)C(CCCCCC)OCCCC |
| InChI | InChI=1S/C60H123O13P/c1-13-25-37-40-43-55(62-46-28-16-4)58(65-49-31-19-7,66-50-32-20-8)71-74(61,72-59(67-51-33-21-9,68-52-34-22-10)56(63-47-29-17-5)44-41-38-26-14-2)73-60(69-53-35-23-11,70-54-36-24-12)57(64-48-30-18-6)45-42-39-27-15-3/h55-57H,13-54H2,1-12H3 |
| InChIKey | SLMYGZKOYSYTAS-UHFFFAOYSA-N |
| XLogP | 18.47 |
| TPSA | 127.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 60 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.60 |
| LogP ≤ 5 | 18.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|