C28H58O4Ti — CID 88526182
titanium;1,1,2-triheptoxyheptan-1-ol (PubChem CID 88526182) has the molecular formula C28H58O4Ti and a molecular weight of 506.64 g/mol. Its IUPAC name is titanium;1,1,2-triheptoxyheptan-1-ol.
| Compound Name | titanium;1,1,2-triheptoxyheptan-1-ol |
|---|---|
| PubChem CID | 88526182 |
| Molecular Formula | C28H58O4Ti |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | titanium;1,1,2-triheptoxyheptan-1-ol |
| SMILES | CCCCCCCOC(CCCCC)C(O)(OCCCCCCC)OCCCCCCC.[Ti] |
| InChI | InChI=1S/C28H58O4.Ti/c1-5-9-13-16-20-24-30-27(23-19-12-8-4)28(29,31-25-21-17-14-10-6-2)32-26-22-18-15-11-7-3;/h27,29H,5-26H2,1-4H3; |
| InChIKey | SIRADWIRXASCAH-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|