C29H60O4 — CID 161487302
2-decoxy-1,1,1-tripropoxydecane (PubChem CID 161487302) has the molecular formula C29H60O4 and a molecular weight of 472.80 g/mol. Its IUPAC name is 2-decoxy-1,1,1-tripropoxydecane.
| Compound Name | 2-decoxy-1,1,1-tripropoxydecane |
|---|---|
| PubChem CID | 161487302 |
| Molecular Formula | C29H60O4 |
| Molecular Weight | 472.80 g/mol |
| Exact Mass | 472.45 |
| IUPAC Name | 2-decoxy-1,1,1-tripropoxydecane |
| SMILES | CCCCCCCCCCOC(CCCCCCCC)C(OCCC)(OCCC)OCCC |
| InChI | InChI=1S/C29H60O4/c1-6-11-13-15-17-18-20-22-27-30-28(23-21-19-16-14-12-7-2)29(31-24-8-3,32-25-9-4)33-26-10-5/h28H,6-27H2,1-5H3 |
| InChIKey | VHGPTKLYBUUBAK-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.80 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|