C15H32O4 — CID 87525337
2-(hydroxymethyl)-2-(1-pentoxyhexyl)propane-1,3-diol (PubChem CID 87525337) has the molecular formula C15H32O4 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(1-pentoxyhexyl)propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-(1-pentoxyhexyl)propane-1,3-diol |
|---|---|
| PubChem CID | 87525337 |
| Molecular Formula | C15H32O4 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 2-(hydroxymethyl)-2-(1-pentoxyhexyl)propane-1,3-diol |
| SMILES | CCCCCOC(CCCCC)C(CO)(CO)CO |
| InChI | InChI=1S/C15H32O4/c1-3-5-7-9-14(19-10-8-6-4-2)15(11-16,12-17)13-18/h14,16-18H,3-13H2,1-2H3 |
| InChIKey | GLLJNTVSEOZZTN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|