C22H34F12O4 — CID 150127920
1,1,1,2-tetrakis(3,3,3-trifluoropropoxy)decane (PubChem CID 150127920) has the molecular formula C22H34F12O4 and a molecular weight of 590.49 g/mol. Its IUPAC name is 1,1,1,2-tetrakis(3,3,3-trifluoropropoxy)decane.
| Compound Name | 1,1,1,2-tetrakis(3,3,3-trifluoropropoxy)decane |
|---|---|
| PubChem CID | 150127920 |
| Molecular Formula | C22H34F12O4 |
| Molecular Weight | 590.49 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 1,1,1,2-tetrakis(3,3,3-trifluoropropoxy)decane |
| SMILES | CCCCCCCCC(OCCC(F)(F)F)C(OCCC(F)(F)F)(OCCC(F)(F)F)OCCC(F)(F)F |
| InChI | InChI=1S/C22H34F12O4/c1-2-3-4-5-6-7-8-17(35-13-9-18(23,24)25)22(36-14-10-19(26,27)28,37-15-11-20(29,30)31)38-16-12-21(32,33)34/h17H,2-16H2,1H3 |
| InChIKey | FAPRQGQUBQJAMT-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.49 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|