C20H43O7P — CID 87576353
1,1,2-tributoxyoctyl dihydrogen phosphate (PubChem CID 87576353) has the molecular formula C20H43O7P and a molecular weight of 426.53 g/mol. Its IUPAC name is 1,1,2-tributoxyoctyl dihydrogen phosphate.
| Compound Name | 1,1,2-tributoxyoctyl dihydrogen phosphate |
|---|---|
| PubChem CID | 87576353 |
| Molecular Formula | C20H43O7P |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 1,1,2-tributoxyoctyl dihydrogen phosphate |
| SMILES | CCCCCCC(OCCCC)C(OCCCC)(OCCCC)OP(=O)(O)O |
| InChI | InChI=1S/C20H43O7P/c1-5-9-13-14-15-19(24-16-10-6-2)20(25-17-11-7-3,26-18-12-8-4)27-28(21,22)23/h19H,5-18H2,1-4H3,(H2,21,22,23) |
| InChIKey | YLIUPYABNHQURO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|