C23H42O3 — CID 159401472
benzene;1,1,1-triethoxy-2-methyldecane (PubChem CID 159401472) has the molecular formula C23H42O3 and a molecular weight of 366.59 g/mol. Its IUPAC name is benzene;1,1,1-triethoxy-2-methyldecane.
| Compound Name | benzene;1,1,1-triethoxy-2-methyldecane |
|---|---|
| PubChem CID | 159401472 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | benzene;1,1,1-triethoxy-2-methyldecane |
| SMILES | CCCCCCCCC(C)C(OCC)(OCC)OCC.c1ccccc1 |
| InChI | InChI=1S/C17H36O3.C6H6/c1-6-10-11-12-13-14-15-16(5)17(18-7-2,19-8-3)20-9-4;1-2-4-6-5-3-1/h16H,6-15H2,1-5H3;1-6H |
| InChIKey | LNJWOGIIVDFJRV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|