C11H23Cl2O4P — CID 23128735
1,1-dichloro-1-diethoxyphosphorylheptan-2-ol (PubChem CID 23128735) has the molecular formula C11H23Cl2O4P and a molecular weight of 321.18 g/mol. Its IUPAC name is 1,1-dichloro-1-diethoxyphosphorylheptan-2-ol.
| Compound Name | 1,1-dichloro-1-diethoxyphosphorylheptan-2-ol |
|---|---|
| PubChem CID | 23128735 |
| Molecular Formula | C11H23Cl2O4P |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 1,1-dichloro-1-diethoxyphosphorylheptan-2-ol |
| SMILES | CCCCCC(O)C(Cl)(Cl)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H23Cl2O4P/c1-4-7-8-9-10(14)11(12,13)18(15,16-5-2)17-6-3/h10,14H,4-9H2,1-3H3 |
| InChIKey | UBGUZBBUXDAKTJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|