C18H26F12O2 — CID 151916088
2,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-methylundecane (PubChem CID 151916088) has the molecular formula C18H26F12O2 and a molecular weight of 502.38 g/mol. Its IUPAC name is 2,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-methylundecane.
| Compound Name | 2,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-methylundecane |
|---|---|
| PubChem CID | 151916088 |
| Molecular Formula | C18H26F12O2 |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 2,2-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-methylundecane |
| SMILES | CCCCCCCCC(C)C(C)(OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H26F12O2/c1-4-5-6-7-8-9-10-11(2)14(3,31-12(15(19,20)21)16(22,23)24)32-13(17(25,26)27)18(28,29)30/h11-13H,4-10H2,1-3H3 |
| InChIKey | SVUBSWJGLWMGRN-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|