C11H25ClF2NO5P — CID 86678263
2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethanamine;hydrochloride (PubChem CID 86678263) has the molecular formula C11H25ClF2NO5P and a molecular weight of 355.75 g/mol. Its IUPAC name is 2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethanamine;hydrochloride.
| Compound Name | 2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 86678263 |
| Molecular Formula | C11H25ClF2NO5P |
| Molecular Weight | 355.75 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[2-(3-diethoxyphosphoryl-3,3-difluoropropoxy)ethoxy]ethanamine;hydrochloride |
| SMILES | CCOP(=O)(OCC)C(F)(F)CCOCCOCCN.Cl |
| InChI | InChI=1S/C11H24F2NO5P.ClH/c1-3-18-20(15,19-4-2)11(12,13)5-7-16-9-10-17-8-6-14;/h3-10,14H2,1-2H3;1H |
| InChIKey | LDBDHDHICXWXEN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|