C11H21F2O3P — CID 10539959
(E)-1-diethoxyphosphoryl-1,1-difluorohept-2-ene (PubChem CID 10539959) has the molecular formula C11H21F2O3P and a molecular weight of 270.26 g/mol. Its IUPAC name is (E)-1-diethoxyphosphoryl-1,1-difluorohept-2-ene.
| Compound Name | (E)-1-diethoxyphosphoryl-1,1-difluorohept-2-ene |
|---|---|
| PubChem CID | 10539959 |
| Molecular Formula | C11H21F2O3P |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (E)-1-diethoxyphosphoryl-1,1-difluorohept-2-ene |
| SMILES | CCCC/C=C/C(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H21F2O3P/c1-4-7-8-9-10-11(12,13)17(14,15-5-2)16-6-3/h9-10H,4-8H2,1-3H3/b10-9+ |
| InChIKey | DNNCZPPVEFFWLM-MDZDMXLPSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|