C13H23F2O3P — CID 122370470
[(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]cyclohexane (PubChem CID 122370470) has the molecular formula C13H23F2O3P and a molecular weight of 296.29 g/mol. Its IUPAC name is [(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]cyclohexane.
| Compound Name | [(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 122370470 |
| Molecular Formula | C13H23F2O3P |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]cyclohexane |
| SMILES | CCOP(=O)(OCC)C(F)(F)/C=C/C1CCCCC1 |
| InChI | InChI=1S/C13H23F2O3P/c1-3-17-19(16,18-4-2)13(14,15)11-10-12-8-6-5-7-9-12/h10-12H,3-9H2,1-2H3/b11-10+ |
| InChIKey | JLLKLGHRJMFXQH-ZHACJKMWSA-N |
| XLogP | 4.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|