C11H19F2O4P — CID 23421653
(1S,4S)-4-[diethoxyphosphoryl(difluoro)methyl]cyclohex-2-en-1-ol (PubChem CID 23421653) has the molecular formula C11H19F2O4P and a molecular weight of 284.24 g/mol. Its IUPAC name is (1S,4S)-4-[diethoxyphosphoryl(difluoro)methyl]cyclohex-2-en-1-ol.
| Compound Name | (1S,4S)-4-[diethoxyphosphoryl(difluoro)methyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 23421653 |
| Molecular Formula | C11H19F2O4P |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (1S,4S)-4-[diethoxyphosphoryl(difluoro)methyl]cyclohex-2-en-1-ol |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@@H]1C=C[C@@H](O)CC1 |
| InChI | InChI=1S/C11H19F2O4P/c1-3-16-18(15,17-4-2)11(12,13)9-5-7-10(14)8-6-9/h5,7,9-10,14H,3-4,6,8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | PPMHVQGIHAACBZ-NXEZZACHSA-N |
| XLogP | 3.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|